Products 55864-04-5
CAS 55864-04-5 appears in our catalog under these names: 4-Isopropylphenyl Diphenyl Phosphate, 4-(1-Methylethyl)phenyl diphenyl phosphate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 1g, 25 mg, 10 mg, 50 mg, 5 mg, 100 mg.
Diphenyl (4-propan-2-ylphenyl) phosphate (CAS 55864-04-5) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: diphenyl (4-propan-2-ylphenyl) phosphate. InChIKey: JUHFQCKQQLMGAB-UHFFFAOYSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | diphenyl (4-propan-2-ylphenyl) phosphate |
| InChIKey | JUHFQCKQQLMGAB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
4-(1-Methylethyl)phenyl diphenyl phosphate, Diphenyl p-isopropylphenyl phosphate, diphenyl (4-propan-2-ylphenyl) phosphate, (4-isopropylphenyl) diphenyl phosphate, diphenyl 4-(propan-2-yl)phenyl phosphate, Phosphoric acid, 4-(1-methylethyl)phenyl diphenyl ester, Diphenyl 4-isopropylphenyl phosphate, p-Isopropylphenyl diphenyl phosphate, p-Cumenyl phenyl phosphate, orb3144940