Products 803-17-8
CAS 803-17-8 appears in our catalog under these names: Tris-p-anisylphosphine oxide, 95-<97%, Tris(4-methoxyphenyl)phosphine oxide, 97%, 97%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene (CAS 803-17-8) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene. InChIKey: KSTMQPBYFFFVFI-UHFFFAOYSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 1-bis(4-methoxyphenyl)phosphoryl-4-methoxybenzene |
| InChIKey | KSTMQPBYFFFVFI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)