Products 78-32-0
CAS 78-32-0 appears in our catalog under these names: Tri-p-tolyl phosphate, 98%, Phosphoric Acid Tris(4-methylphenyl) Ester, >95% (HPLC), Tri-4-cresyl phosphate, Tri–p–cresyl Phosphate, Tri-p-cresyl Phosphate, >98.0%(GC). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 25g, 5g, 1g, 100mg, 1x100mg.
Tris(4-methylphenyl) phosphate (CAS 78-32-0) is a chemical compound with the molecular formula C21H21O4P and a molecular weight of 368.4 g/mol. IUPAC name: tris(4-methylphenyl) phosphate. InChIKey: BOSMZFBHAYFUBJ-UHFFFAOYSA-N.
| Molecular formula | C21H21O4P |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | tris(4-methylphenyl) phosphate |
| InChIKey | BOSMZFBHAYFUBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=C(C=C2)C)OC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)
Synonyms:
Tri-p-tolyl phosphate, TRI-P-CRESYL PHOSPHATE, Tris(4-methylphenyl) phosphate, Phosphoric acid, tris(4-methylphenyl) ester, Phosphoric acid, tri(4-tolyl)ester, p-Tolyl phosphate ((C7H7O)3PO), TRI-P-CRESYL PHOSPHATE [HSDB], Triptolyl phosphate, Phosphoric acid, triptolyl ester, Phosphoric acid, tri(4tolyl)ester