CAS 2469259-73-0 appears in our catalog under these names: N-Suberyl-2,2,7,7-d4-glycine, 97 atom % D, min 97% Chemical Purity, Suberyl Glycine-d4, >95% (HPLC), Suberylglycine–d4, Suberylglycine-d4, 99%, 99%, Suberylglycine-d4, 99.0%. Offered by: CDN, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 1mg, 2,5mg, 1 mg.
8-(carboxymethylamino)-2,2,7,7-tetradeuterio-8-oxooctanoic acid (CAS 2469259-73-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 235.27 g/mol. IUPAC name: 8-(carboxymethylamino)-2,2,7,7-tetradeuterio-8-oxooctanoic acid. InChIKey: HXATVKDSYDWTCX-NZLXMSDQSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | 8-(carboxymethylamino)-2,2,7,7-tetradeuterio-8-oxooctanoic acid |
| InChIKey | HXATVKDSYDWTCX-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCCC([2H])([2H])C(=O)O)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)