Products 2469263-61-2
CAS 2469263-61-2 appears in our catalog under these names: Serotonin–d4 (hydrochloride), Serotonin-d4 (hydrochloride), 99.48%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg.
3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol;hydrochloride (CAS 2469263-61-2) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 216.70 g/mol. IUPAC name: 3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol;hydrochloride. InChIKey: MDIGAZPGKJFIAH-URZLSVTISA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 216.70 g/mol |
| IUPAC name | 3-(2-amino-1,1,2,2-tetradeuterioethyl)-1H-indol-5-ol;hydrochloride |
| InChIKey | MDIGAZPGKJFIAH-URZLSVTISA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C=C(C=C2)O)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)