CAS 54864-96-9 appears in our catalog under these names: 6-Chloro-N,N-diethylpyridine-3-carboxamide, 96%, 6-chloro-N,N-diethylnicotinamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
6-chloro-N,N-diethylpyridine-3-carboxamide (CAS 54864-96-9) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 6-chloro-N,N-diethylpyridine-3-carboxamide. InChIKey: DEWSDUANQYRLFT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 6-chloro-N,N-diethylpyridine-3-carboxamide |
| InChIKey | DEWSDUANQYRLFT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)