Products 76712-84-0
CAS 76712-84-0 appears in our catalog under these names: [3-(1,3-Benzoxazol-2-yl)propyl]amine hydrochloride, 95%, 3-(Benzo(d)oxazol-2-yl)propan-1-amine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-(1,3-benzoxazol-2-yl)propan-1-amine;hydrochloride (CAS 76712-84-0) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 3-(1,3-benzoxazol-2-yl)propan-1-amine;hydrochloride. InChIKey: STFABMGASHAZIE-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-(1,3-benzoxazol-2-yl)propan-1-amine;hydrochloride |
| InChIKey | STFABMGASHAZIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CCCN.Cl |
Computed by PubChem (NCBI)