CAS 468718-69-6 appears in our catalog under these names: N-(3-Chloropyridin-2-yl)-2,2-dimethylpropanamide, 95%, N-(3-Chloropyridin-2-yl)-2,2-dimethylpropanamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N-(3-chloro-2-pyridinyl)-2,2-dimethylpropanamide (CAS 468718-69-6) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-(3-chloro-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: HHGRYBJCZLWBBB-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-(3-chloro-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | HHGRYBJCZLWBBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC=N1)Cl |
Computed by PubChem (NCBI)