Products 1956354-60-1
CAS 1956354-60-1 appears in our catalog under these names: 1-(4-Aminophenyl)pyrrolidin-2-one hydrochloride, 95%, 1-(4-Aminophenyl)pyrrolidin-2-one hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
1-(4-aminophenyl)pyrrolidin-2-one;hydrochloride (CAS 1956354-60-1) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 1-(4-aminophenyl)pyrrolidin-2-one;hydrochloride. InChIKey: FLSZVSFEAHGJEL-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 1-(4-aminophenyl)pyrrolidin-2-one;hydrochloride |
| InChIKey | FLSZVSFEAHGJEL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)