CAS 247062-03-9 appears in our catalog under these names: 3-Amino-2-hydroxy-4-phenylbutanamide hydrochloride, 95+%, 3-Amino-2-hydroxy-4-phenylbutanamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
3-amino-2-hydroxy-4-phenylbutanamide;hydrochloride (CAS 247062-03-9) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 3-amino-2-hydroxy-4-phenylbutanamide;hydrochloride. InChIKey: CLQMCTADJQLZSO-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 3-amino-2-hydroxy-4-phenylbutanamide;hydrochloride |
| InChIKey | CLQMCTADJQLZSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(C(=O)N)O)N.Cl |
Computed by PubChem (NCBI)