CAS 247128-20-7 appears in our catalog under these names: 2-Hydroxymethyl-1h-benzoimidazole-5-carboxylic acid hydrochloride, 95%, 2-(Hydroxymethyl)-1h-benzimidazole-5-carboxylic acid, 98%, 2-(Hydroxymethyl)-1h-benzimidazole-6-carboxylic acid, 95%, 2-Hydroxymethyl-1H-benzoimidazole-5-carboxylicacid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid (CAS 247128-20-7) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid. InChIKey: LIBZUTVUUNNXNP-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2-(hydroxymethyl)-3H-benzimidazole-5-carboxylic acid |
| InChIKey | LIBZUTVUUNNXNP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)CO |
Computed by PubChem (NCBI)