Products 247128-24-1
CAS 247128-24-1 is the registry number for 3-Indazol-1-yl-propionic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-indazol-1-ylpropanoic acid (CAS 247128-24-1) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-indazol-1-ylpropanoic acid. InChIKey: KWLUWAKLSFDQNN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-indazol-1-ylpropanoic acid |
| InChIKey | KWLUWAKLSFDQNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN2CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(1H-indazol-1-yl)propanoic acid, 3-Indazol-1-yl-propionic acid, 3-indazol-1-ylpropanoic acid, 3-(1H-indazolyl)propanoic acid, 3-(1h-indazol-1-yl)propionic acid, Cambridge id 5566199, KWLUWAKLSFDQNN-UHFFFAOYSA-N, 3-(1H-indazol-1-yl)propanoicacid, 6(4fluorophenyl)3,3,5,5tetramethyldihydro2hpyran2,4(3h)dione