Products 24786-54-7
CAS 24786-54-7 appears in our catalog under these names: 6-Bromo-1-methyl-1H-1,3-benzodiazol-2-amine, 6-Bromo-1-methyl-1H-benzimidazol-2-amine, 98%, 98%, 6-Bromo-1-methyl-1h-1,3-benzodiazol-2-amine, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 500mg, 2.5g, 5g.
6-bromo-1-methylbenzimidazol-2-amine (CAS 24786-54-7) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-1-methylbenzimidazol-2-amine. InChIKey: OEHIYNMMAZCNCE-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-1-methylbenzimidazol-2-amine |
| InChIKey | OEHIYNMMAZCNCE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)N=C1N |
Computed by PubChem (NCBI)