Products 2480109-98-4
CAS 2480109-98-4 is the registry number for (9H-Fluorene-2,7-diyl)bis(phenylmethanone), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[3-(hydroxymethyl)-1,1-dioxothietan-3-yl]carbamate (CAS 2480109-98-4) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: tert-butyl N-[3-(hydroxymethyl)-1,1-dioxothietan-3-yl]carbamate. InChIKey: YENPFQHLYBMRED-UHFFFAOYSA-N.
| Molecular formula | C9H17NO5S |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | tert-butyl N-[3-(hydroxymethyl)-1,1-dioxothietan-3-yl]carbamate |
| InChIKey | YENPFQHLYBMRED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CS(=O)(=O)C1)CO |
Computed by PubChem (NCBI)