CAS 24805-54-7 appears in our catalog under these names: Methyl 3-nitro-2,4-dimethylbenzoate, 95%, Methyl 2,4-dimethyl-3-nitrobenzoate, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Methyl 2,4-dimethyl-3-nitrobenzoate (CAS 24805-54-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 2,4-dimethyl-3-nitrobenzoate. InChIKey: YSUYMIMLCZOBJX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 2,4-dimethyl-3-nitrobenzoate |
| InChIKey | YSUYMIMLCZOBJX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)