Products 24807-37-2
CAS 24807-37-2 appears in our catalog under these names: 3-(3-(Benzyloxy)-4-methoxyphenyl)acrylic acid, 98%, 98%, 3-(3-(Benzyloxy)-4-methoxyphenyl)acrylic acid, 98%, 3-(3-(Benzyloxy)-4-methoxyphenyl)acrylic acid, 95% (E). Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 250mg, 1g, 5g, 25g.
(E)-3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enoic acid (CAS 24807-37-2) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (E)-3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: FQCWLBGBAQCDJF-CSKARUKUSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (E)-3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | FQCWLBGBAQCDJF-CSKARUKUSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)