Products 2483830-04-0

CAS 2483830-04-0 is the registry number for L-Serine1-13C,15N, 98.90%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

(2S)-2-(15N)azanyl-3-hydroxy(113C)propanoic acid (CAS 2483830-04-0) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 107.08 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-hydroxy(113C)propanoic acid. InChIKey: MTCFGRXMJLQNBG-WGVUESGYSA-N.

Identity
Molecular formulaC3H7NO3
Molecular weight107.08 g/mol
IUPAC name(2S)-2-(15N)azanyl-3-hydroxy(113C)propanoic acid
InChIKeyMTCFGRXMJLQNBG-WGVUESGYSA-N
SMILESC([C@@H]([13C](=O)O)[15NH2])O

Computed by PubChem (NCBI)