Products 2483830-60-8
CAS 2483830-60-8 appears in our catalog under these names: Flonicamid–15N,18O, Flonicamid-15N,18O, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1,2ml, 120 μg (430.76 μM * 1.2 mL in Methanol).
N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-(15N,18O)carboxamide (CAS 2483830-60-8) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 232.15 g/mol. IUPAC name: N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-(15N,18O)carboxamide. InChIKey: RLQJEEJISHYWON-ZNQGSEOTSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-(15N,18O)carboxamide |
| InChIKey | RLQJEEJISHYWON-ZNQGSEOTSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)C(=[18O])[15NH]CC#N |
Computed by PubChem (NCBI)