Products 2487-26-5
CAS 2487-26-5 appears in our catalog under these names: 2-Nitrophenyl butyrate, 97%, 2–Nitrophenyl butyrate, 2-Nitrophenyl butyrate, 2-Nitrophenyl butyrate 97%, 2-Nitrophenyl butyrate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
(2-nitrophenyl) butanoate (CAS 2487-26-5) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2-nitrophenyl) butanoate. InChIKey: DMBLCROMMOZRCN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2-nitrophenyl) butanoate |
| InChIKey | DMBLCROMMOZRCN-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)