CAS 248924-59-6 appears in our catalog under these names: 3–Furanboronic acid pinacol ester, Furan-3-boronic acid pinacol ester/ 95+%, 3-Furanboronic acid pinacol ester, 98%, 98%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
2-(furan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 248924-59-6) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: 2-(furan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KTBLRYUFNBABGO-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | 2-(furan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KTBLRYUFNBABGO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COC=C2 |
Computed by PubChem (NCBI)