Products 2492600-98-1

CAS 2492600-98-1 is the registry number for 3,4-Dichlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3,4-dichlorobenzoyl fluoride (CAS 2492600-98-1) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 3,4-dichlorobenzoyl fluoride. InChIKey: NXZMGOOLRYYQHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2FO
Molecular weight193.00 g/mol
IUPAC name3,4-dichlorobenzoyl fluoride
InChIKeyNXZMGOOLRYYQHQ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)F)Cl)Cl

Computed by PubChem (NCBI)