CAS 2492600-98-1 is the registry number for 3,4-Dichlorobenzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dichlorobenzoyl fluoride (CAS 2492600-98-1) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 3,4-dichlorobenzoyl fluoride. InChIKey: NXZMGOOLRYYQHQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 3,4-dichlorobenzoyl fluoride |
| InChIKey | NXZMGOOLRYYQHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)F)Cl)Cl |
Computed by PubChem (NCBI)