CAS 2493977-47-0 is the registry number for 4-Chloro-N,N-dimethylcathinone hydrochloride. Offered by: Biosynth. Available pack sizes: 1mg.
1-(4-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride (CAS 2493977-47-0) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride. InChIKey: UERYKHQEPFHRHZ-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride |
| InChIKey | UERYKHQEPFHRHZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)