CAS 2494274-04-1 is the registry number for 5-(1-Hydroxynaphthalen-2-yl)-1,3,4-oxadiazole-2(3H)-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1-hydroxynaphthalen-2-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 2494274-04-1) is a chemical compound with the molecular formula C12H8N2O2S and a molecular weight of 244.27 g/mol. IUPAC name: 5-(1-hydroxynaphthalen-2-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: GTVLUGGCTHELBU-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 5-(1-hydroxynaphthalen-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | GTVLUGGCTHELBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)