Products 249889-68-7
CAS 249889-68-7 appears in our catalog under these names: 8-Chloro-2-methoxy-1,5-naphthyridine, 97%, 8-Chloro-2-methoxy-1,5-naphthyridine 97%, 8-Chloro-2-methoxy-1,5-naphthyridine, ≥97%, ≥97%, 8-Chloro-2-methoxy-1,5-naphthyridine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
8-chloro-2-methoxy-1,5-naphthyridine (CAS 249889-68-7) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 8-chloro-2-methoxy-1,5-naphthyridine. InChIKey: OPAVZRJSEDSFMQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 8-chloro-2-methoxy-1,5-naphthyridine |
| InChIKey | OPAVZRJSEDSFMQ-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=CN=C2C=C1)Cl |
Computed by PubChem (NCBI)