CAS 250264-28-9 appears in our catalog under these names: 5-Chloro-1H-1,8-naphthyridin-2-one, 5-Chloro-1,8-naphthyridin-2(1H)-one, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
5-chloro-1H-1,8-naphthyridin-2-one (CAS 250264-28-9) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 5-chloro-1H-1,8-naphthyridin-2-one. InChIKey: DIHDSAINCRHSHA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 5-chloro-1H-1,8-naphthyridin-2-one |
| InChIKey | DIHDSAINCRHSHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=NC=CC(=C21)Cl |
Computed by PubChem (NCBI)