Products 2508-89-6
CAS 2508-89-6 is the registry number for Duazomycin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-acetamido-6-diazo-5-oxohexanoic acid (CAS 2508-89-6) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: (2S)-2-acetamido-6-diazo-5-oxohexanoic acid. InChIKey: WBSWOKCKZUNHQV-ZETCQYMHSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (2S)-2-acetamido-6-diazo-5-oxohexanoic acid |
| InChIKey | WBSWOKCKZUNHQV-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)