Products 251085-87-7
CAS 251085-87-7 appears in our catalog under these names: Methyl 5–bromo–2–chlorobenzoate, Methyl 5-bromo-2-chlorobenzoate 98%, Methyl 5-bromo-2-chlorobenzoate, 98%, 98%, Methyl 5-bromo-2-chlorobenzoate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 10g.
Methyl 5-bromo-2-chlorobenzoate (CAS 251085-87-7) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 5-bromo-2-chlorobenzoate. InChIKey: DOVGGQQIXPPXDC-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 5-bromo-2-chlorobenzoate |
| InChIKey | DOVGGQQIXPPXDC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)