Products 25111-96-0
CAS 25111-96-0 is the registry number for Antiviral agent 67. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (CAS 25111-96-0) is a chemical compound with the molecular formula C19H19N3O and a molecular weight of 305.4 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one. InChIKey: YJCRUYAVDCDVCD-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| InChIKey | YJCRUYAVDCDVCD-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1=CC2=CC=C(C=C2)N(C)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)