CAS 251300-29-5 appears in our catalog under these names: 5–Bromo–3–fluoro–2–hydroxybenzoic acid, 5-Bromo-3-fluoro-2-hydroxybenzoic acid, 5-Bromo-3-fluoro-2-hydroxybenzoic acid 95%, 5-Bromo-3-fluoro-2-hydroxybenzoic acid, 95%, 95%, 5-Bromo-3-fluoro-2-hydroxybenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g.
5-bromo-3-fluoro-2-hydroxybenzoic acid (CAS 251300-29-5) is a chemical compound with the molecular formula C7H4BrFO3 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-3-fluoro-2-hydroxybenzoic acid. InChIKey: UKIJWZUOZRTSDX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO3 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 5-bromo-3-fluoro-2-hydroxybenzoic acid |
| InChIKey | UKIJWZUOZRTSDX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)F)Br |
Computed by PubChem (NCBI)