CAS 2514963-19-8 is the registry number for 4,6-Dichloro-α-phenyl-3-pyridinemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4,6-dichloro-3-pyridinyl)-phenylmethanol (CAS 2514963-19-8) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: (4,6-dichloro-3-pyridinyl)-phenylmethanol. InChIKey: RWEJKTRMKHAWEF-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | (4,6-dichloro-3-pyridinyl)-phenylmethanol |
| InChIKey | RWEJKTRMKHAWEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CN=C(C=C2Cl)Cl)O |
Computed by PubChem (NCBI)