CAS 2517584-45-9 is the registry number for Methyl 5-Hydroxy-2-benzimidazolecarbamate-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
Trideuteriomethyl N-(6-hydroxy-1H-benzimidazol-2-yl)carbamate (CAS 2517584-45-9) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 210.20 g/mol. IUPAC name: trideuteriomethyl N-(6-hydroxy-1H-benzimidazol-2-yl)carbamate. InChIKey: UINGPWWYGSJYAY-FIBGUPNXSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | trideuteriomethyl N-(6-hydroxy-1H-benzimidazol-2-yl)carbamate |
| InChIKey | UINGPWWYGSJYAY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)O |
Computed by PubChem (NCBI)