CAS 957514-13-5 is the registry number for 5-Methyl-4-(1h-pyrazol-1-ylmethyl)isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-methyl-4-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid (CAS 957514-13-5) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-methyl-4-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid. InChIKey: ZJONGZNJRXNHOC-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-methyl-4-(pyrazol-1-ylmethyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | ZJONGZNJRXNHOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)CN2C=CC=N2 |
Computed by PubChem (NCBI)