CAS 957484-18-3 is the registry number for 3-(1,5-Dimethyl-1h-pyrazol-4-yl)isoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957484-18-3) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: BTSNBPGQHKIMQJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | BTSNBPGQHKIMQJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)