Products 957484-18-3

CAS 957484-18-3 is the registry number for 3-(1,5-Dimethyl-1h-pyrazol-4-yl)isoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid (CAS 957484-18-3) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: BTSNBPGQHKIMQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O3
Molecular weight207.19 g/mol
IUPAC name3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole-5-carboxylic acid
InChIKeyBTSNBPGQHKIMQJ-UHFFFAOYSA-N
SMILESCC1=C(C=NN1C)C2=NOC(=C2)C(=O)O

Computed by PubChem (NCBI)