CAS 956369-25-8 is the registry number for 5-(1,3-Dimethyl-1h-pyrazol-4-yl)isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 956369-25-8) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: POAACBFRLKLYDU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | POAACBFRLKLYDU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C2=CC(=NO2)C(=O)O)C |
Computed by PubChem (NCBI)