Products 956369-25-8

CAS 956369-25-8 is the registry number for 5-(1,3-Dimethyl-1h-pyrazol-4-yl)isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 956369-25-8) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: POAACBFRLKLYDU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O3
Molecular weight207.19 g/mol
IUPAC name5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid
InChIKeyPOAACBFRLKLYDU-UHFFFAOYSA-N
SMILESCC1=NN(C=C1C2=CC(=NO2)C(=O)O)C

Computed by PubChem (NCBI)