CAS 893751-88-7 appears in our catalog under these names: 4-(1H-Imidazol-1-ylmethyl)-5-methylisoxazole-3-carboxylic acid, 95%, 4-((1H-Imidazol-1-yl)methyl)-5-methylisoxazole-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-(imidazol-1-ylmethyl)-5-methyl-1,2-oxazole-3-carboxylic acid (CAS 893751-88-7) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 4-(imidazol-1-ylmethyl)-5-methyl-1,2-oxazole-3-carboxylic acid. InChIKey: KJENJEJHBPHCQT-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 4-(imidazol-1-ylmethyl)-5-methyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | KJENJEJHBPHCQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)O)CN2C=CN=C2 |
Computed by PubChem (NCBI)