Products 2518245-81-1
CAS 2518245-81-1 is the registry number for 4,6-Dichloro-2-fluoronicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-fluoropyridine-3-carboxylic acid (CAS 2518245-81-1) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 4,6-dichloro-2-fluoropyridine-3-carboxylic acid. InChIKey: BGGGPOHLHMSUEK-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 4,6-dichloro-2-fluoropyridine-3-carboxylic acid |
| InChIKey | BGGGPOHLHMSUEK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)F)C(=O)O)Cl |
Computed by PubChem (NCBI)