CAS 2518343-81-0 appears in our catalog under these names: Ketorolac Impurity 16, 6-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg, 100mg.
6-benzoyl-2,3-dihydropyrrolizin-1-one (CAS 2518343-81-0) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 6-benzoyl-2,3-dihydropyrrolizin-1-one. InChIKey: WHMHELXHHVTMJF-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 6-benzoyl-2,3-dihydropyrrolizin-1-one |
| InChIKey | WHMHELXHHVTMJF-UHFFFAOYSA-N |
| SMILES | C1CN2C=C(C=C2C1=O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)