Products 2525094-72-6
CAS 2525094-72-6 appears in our catalog under these names: Methyl 3-(1-aminocyclopropyl)benzoate hydrochloride, 95%, Methyl 3-(1-aminocyclopropyl)benzoate hydrochloride, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-(1-aminocyclopropyl)benzoate;hydrochloride (CAS 2525094-72-6) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 3-(1-aminocyclopropyl)benzoate;hydrochloride. InChIKey: MDKOMHPGEDQSAH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 3-(1-aminocyclopropyl)benzoate;hydrochloride |
| InChIKey | MDKOMHPGEDQSAH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)C2(CC2)N.Cl |
Computed by PubChem (NCBI)