Products 599179-75-6
CAS 599179-75-6 is the registry number for 2-[[(4-Nitrophenoxy)carbonyl]oxy]ethyl Methacrylate, >98.0%(GC). Offered by: TCI. Available pack sizes: 1g, 5g.
2-(4-nitrophenoxy)carbonyloxyethyl 2-methylprop-2-enoate (CAS 599179-75-6) is a chemical compound with the molecular formula C13H13NO7 and a molecular weight of 295.24 g/mol. IUPAC name: 2-(4-nitrophenoxy)carbonyloxyethyl 2-methylprop-2-enoate. InChIKey: AQIDUOGOBUBBOB-UHFFFAOYSA-N.
| Molecular formula | C13H13NO7 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)carbonyloxyethyl 2-methylprop-2-enoate |
| InChIKey | AQIDUOGOBUBBOB-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)