Products 253136-56-0
CAS 253136-56-0 is the registry number for (S)-2-Methylindoline-2-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2S)-2-methyl-1,3-dihydroindole-2-carboxylic acid (CAS 253136-56-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (2S)-2-methyl-1,3-dihydroindole-2-carboxylic acid. InChIKey: ITHZTEGECADJIH-JTQLQIEISA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (2S)-2-methyl-1,3-dihydroindole-2-carboxylic acid |
| InChIKey | ITHZTEGECADJIH-JTQLQIEISA-N |
| SMILES | C[C@]1(CC2=CC=CC=C2N1)C(=O)O |
Computed by PubChem (NCBI)