CAS 253185-43-2 is the registry number for 1-Amino-4,5-dihydro-1H-benzo(d)azepin-2(3H)-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one (CAS 253185-43-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one. InChIKey: QWJOGPWJTLUXTM-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 5-amino-1,2,3,5-tetrahydro-3-benzazepin-4-one |
| InChIKey | QWJOGPWJTLUXTM-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C(C2=CC=CC=C21)N |
Computed by PubChem (NCBI)