CAS 253595-72-1 is the registry number for Z-N-Me-thr-oh cha, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S,3R)-3-hydroxy-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid (CAS 253595-72-1) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: (2S,3R)-3-hydroxy-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid. InChIKey: VTXCJGLSFIOQNL-KOLCDFICSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2S,3R)-3-hydroxy-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid |
| InChIKey | VTXCJGLSFIOQNL-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)