CAS 2536-05-2 appears in our catalog under these names: 2,2'-Methylenediphenyl Diisocyanate, 2,2'-METHYLENEDIPHENYL DIISOCYANATE, 98%, 98%, 2,2'-Methylenediphenyl diisocyanate, 50 mg, 2,2'-Methylenediphenyl diisocyanate, 100 mg, 2,2'-Methylenediphenyl diisocyanate, 250 mg. Offered by: Chemat Brand, Chemat, Roth. Available pack sizes: on request, 10mg, 50mg, 250mg, 100mg.
1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene (CAS 2536-05-2) is a chemical compound with the molecular formula C15H10N2O2 and a molecular weight of 250.25 g/mol. IUPAC name: 1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene. InChIKey: JIABEENURMZTTI-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O2 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 1-isocyanato-2-[(2-isocyanatophenyl)methyl]benzene |
| InChIKey | JIABEENURMZTTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=CC=CC=C2N=C=O)N=C=O |
Computed by PubChem (NCBI)