Products 25373-33-5
CAS 25373-33-5 is the registry number for 2,3-Dihydro-2-(2-nitrophenyl)benzothiazole, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole (CAS 25373-33-5) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 2-(2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole. InChIKey: WJZSCAFGGRLBRA-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-2,3-dihydro-1,3-benzothiazole |
| InChIKey | WJZSCAFGGRLBRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2NC3=CC=CC=C3S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)