Products 25406-44-4
CAS 25406-44-4 appears in our catalog under these names: N4,5-Dimethyldeoxycytidine, >95% (HPLC), 2'-Deoxy-N4,5-dimethylcytidine, 2’-Deoxy-5,N4-dimethylcytidine, 97.47%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 1 mg, 10 mg, 5 mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-(methylamino)pyrimidin-2-one (CAS 25406-44-4) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-(methylamino)pyrimidin-2-one. InChIKey: SUURDKULGPGHGO-DJLDLDEBSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-(methylamino)pyrimidin-2-one |
| InChIKey | SUURDKULGPGHGO-DJLDLDEBSA-N |
| SMILES | CC1=CN(C(=O)N=C1NC)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)