Products 2540664-50-2

CAS 2540664-50-2 is the registry number for N–Moc–MDMA. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylcarbamate (CAS 2540664-50-2) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: methyl N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylcarbamate. InChIKey: UULQZCBUMWMNBY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO4
Molecular weight251.28 g/mol
IUPAC namemethyl N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-methylcarbamate
InChIKeyUULQZCBUMWMNBY-UHFFFAOYSA-N
SMILESCC(CC1=CC2=C(C=C1)OCO2)N(C)C(=O)OC

Computed by PubChem (NCBI)

Synonyms: N-Moc-MDMA