CAS 776331-48-7 appears in our catalog under these names: 1-(Phenylmethyl) (3S)-3-[[(1,1-dimethylethoxy)carbonyl]amino]pentanedioate, 95%, 95%, (3S)-5-(Benzyloxy)-3-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 776331-48-7) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: FAFJSSKTLCNWRJ-ZDUSSCGKSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | FAFJSSKTLCNWRJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)CC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)