CAS 25566-00-1 appears in our catalog under these names: 1-Benzoylazetidin-3-ol, 1-Benzoylazetidin-3-ol, 98%, (3-Hydroxyazetidin-1-yl)(phenyl)methanone, 98%, 98%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 5g, 10g, 50mg, 250mg, 500mg, 2.5g.
(3-hydroxyazetidin-1-yl)-phenylmethanone (CAS 25566-00-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (3-hydroxyazetidin-1-yl)-phenylmethanone. InChIKey: MQPNDHHRMVRTCE-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (3-hydroxyazetidin-1-yl)-phenylmethanone |
| InChIKey | MQPNDHHRMVRTCE-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)