Products 25589-41-7
CAS 25589-41-7 is the registry number for 4-[(4-Bromophenyl)amino]-4-oxobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-bromoanilino)-4-oxobutanoic acid (CAS 25589-41-7) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: 4-(4-bromoanilino)-4-oxobutanoic acid. InChIKey: MJQBQVIGARYLLU-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 4-(4-bromoanilino)-4-oxobutanoic acid |
| InChIKey | MJQBQVIGARYLLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCC(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
4'-bromosuccinanilic acid, 4-[(4-bromophenyl)amino]-4-oxobutanoic acid, 3-[(4-bromophenyl)carbamoyl]propanoic acid, 4-(4-bromoanilino)-4-oxobutanoic acid, 4-((4-bromophenyl)amino)-4-oxobutanoic acid, CBDivE_001291, Butanoic acid, 4-[(4-bromophenyl)amino]-4-oxo-, Oprea1_263880, N-(4-Bromophenyl)succinamic acid, 4-(4-bromoanilino)-4-oxo-butanoic acid