Products 25630-24-4
CAS 25630-24-4 is the registry number for Benzenesulfonamide,N,N-di-2-propen-1-yl-, 99%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N,N-bis(prop-2-enyl)benzenesulfonamide (CAS 25630-24-4) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: N,N-bis(prop-2-enyl)benzenesulfonamide. InChIKey: ZDOYMEKSBOLOOS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | N,N-bis(prop-2-enyl)benzenesulfonamide |
| InChIKey | ZDOYMEKSBOLOOS-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)